C22H24O5 — CID 142513776
1-[3-acetyl-5-(3,5-diacetylphenoxy)phenyl]ethanone;ethane (PubChem CID 142513776) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[3-acetyl-5-(3,5-diacetylphenoxy)phenyl]ethanone;ethane.
| Compound Name | 1-[3-acetyl-5-(3,5-diacetylphenoxy)phenyl]ethanone;ethane |
|---|---|
| PubChem CID | 142513776 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[3-acetyl-5-(3,5-diacetylphenoxy)phenyl]ethanone;ethane |
| SMILES | CC.CC(=O)c1cc(Oc2cc(C(C)=O)cc(C(C)=O)c2)cc(C(C)=O)c1 |
| InChI | InChI=1S/C20H18O5.C2H6/c1-11(21)15-5-16(12(2)22)8-19(7-15)25-20-9-17(13(3)23)6-18(10-20)14(4)24;1-2/h5-10H,1-4H3;1-2H3 |
| InChIKey | KPEULZVHUPQCNR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |