C14H20O5 — CID 118893996
1-[3,5-bis(3-hydroxypropoxy)phenyl]ethanone (PubChem CID 118893996) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[3,5-bis(3-hydroxypropoxy)phenyl]ethanone.
| Compound Name | 1-[3,5-bis(3-hydroxypropoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 118893996 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[3,5-bis(3-hydroxypropoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(OCCCO)cc(OCCCO)c1 |
| InChI | InChI=1S/C14H20O5/c1-11(17)12-8-13(18-6-2-4-15)10-14(9-12)19-7-3-5-16/h8-10,15-16H,2-7H2,1H3 |
| InChIKey | XUFDYQLFPHMZLY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|