About 3,5-diacetyl-N-methylbenzamide;ethane
3,5-diacetyl-N-methylbenzamide;ethane (PubChem CID 142854666) has the molecular formula C22H43NO3
and a molecular weight of 369.59 g/mol. Its IUPAC name is 3,5-diacetyl-N-methylbenzamide;ethane.
Molecular Properties
| Compound Name | 3,5-diacetyl-N-methylbenzamide;ethane |
| PubChem CID | 142854666 |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.32 |
| IUPAC Name | 3,5-diacetyl-N-methylbenzamide;ethane |
| SMILES | CC.CC.CC.CC.CC.CNC(=O)c1cc(C(C)=O)cc(C(C)=O)c1 |
| InChI | InChI=1S/C12H13NO3.5C2H6/c1-7(14)9-4-10(8(2)15)6-11(5-9)12(16)13-3;5*1-2/h4-6H,1-3H3,(H,13,16);5*1-2H3 |
| InChIKey | CBRPRUXLHXZWPJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diacetyl-N-methylbenzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diacetyl-N-methylbenzamide;ethane?
The IUPAC name of 3,5-diacetyl-N-methylbenzamide;ethane (CID 142854666) is 3,5-diacetyl-N-methylbenzamide;ethane.
What is the SMILES notation for 3,5-diacetyl-N-methylbenzamide;ethane?
The canonical SMILES for 3,5-diacetyl-N-methylbenzamide;ethane is CC.CC.CC.CC.CC.CNC(=O)c1cc(C(C)=O)cc(C(C)=O)c1.
What is the InChIKey of 3,5-diacetyl-N-methylbenzamide;ethane?
The InChIKey is CBRPRUXLHXZWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3.5C2H6/c1-7(14)9-4-10(8(2)15)6-11(5-9)12(16)13-3;5*1-2/h4-6H,1-3H3,(H,13,16);5*1-2H3.
What are the key properties of 3,5-diacetyl-N-methylbenzamide;ethane?
3,5-diacetyl-N-methylbenzamide;ethane has a molecular weight of 369.59 g/mol, XLogP of 6.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diacetyl-N-methylbenzamide;ethane is sourced from PubChem (CID 142854666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).