C10H14ClNO — CID 139561221
N,3,5-trimethylbenzamide;hydrochloride (PubChem CID 139561221) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is N,3,5-trimethylbenzamide;hydrochloride.
| Compound Name | N,3,5-trimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 139561221 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N,3,5-trimethylbenzamide;hydrochloride |
| SMILES | CNC(=O)c1cc(C)cc(C)c1.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-7-4-8(2)6-9(5-7)10(12)11-3;/h4-6H,1-3H3,(H,11,12);1H |
| InChIKey | CGGJVFRWHLWWHT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |