C19H21N3O3 — CID 18146235
3,5-dimethyl-N-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]benzamide (PubChem CID 18146235) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 18146235 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3,5-dimethyl-N-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CNC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-7-13(2)9-15(8-12)19(25)21-11-17(23)22-16-6-4-5-14(10-16)18(24)20-3/h4-10H,11H2,1-3H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | LWVQFHDRPRVSCX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |