C22H27N3O3 — CID 26712597
N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 26712597) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 26712597 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CNC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-5-25(6-2)22(28)17-8-7-9-19(13-17)24-20(26)14-23-21(27)18-11-15(3)10-16(4)12-18/h7-13H,5-6,14H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | GJISSCDDJUDZGA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |