C32H46N4O4 — CID 17194651
N,N'-bis[3-(diethylcarbamoyl)phenyl]decanediamide (PubChem CID 17194651) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is N,N'-bis[3-(diethylcarbamoyl)phenyl]decanediamide.
| Compound Name | N,N'-bis[3-(diethylcarbamoyl)phenyl]decanediamide |
|---|---|
| PubChem CID | 17194651 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | N,N'-bis[3-(diethylcarbamoyl)phenyl]decanediamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CCCCCCCCC(=O)Nc2cccc(C(=O)N(CC)CC)c2)c1 |
| InChI | InChI=1S/C32H46N4O4/c1-5-35(6-2)31(39)25-17-15-19-27(23-25)33-29(37)21-13-11-9-10-12-14-22-30(38)34-28-20-16-18-26(24-28)32(40)36(7-3)8-4/h15-20,23-24H,5-14,21-22H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | RHKOIQXREMIBDA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|