C23H30N4O3 — CID 54837209
3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 54837209) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 54837209 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(NCC(=O)Nc2cccc(C(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-8-21(28)25-19-13-11-18(12-14-19)24-16-22(29)26-20-10-7-9-17(15-20)23(30)27(5-2)6-3/h7,9-15,24H,4-6,8,16H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | IJAOTHHQEVGOSG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |