C27H31N3O4 — CID 54822926
N,N-diethyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide (PubChem CID 54822926) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54822926 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N,N-diethyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CNc2ccc(OCCOc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H31N3O4/c1-3-30(4-2)27(32)21-9-8-10-23(19-21)29-26(31)20-28-22-13-15-25(16-14-22)34-18-17-33-24-11-6-5-7-12-24/h5-16,19,28H,3-4,17-18,20H2,1-2H3,(H,29,31) |
| InChIKey | CPZNLNHJFCMORX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|