C22H26N2O5 — CID 8579079
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-phenoxypropanoate (PubChem CID 8579079) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-phenoxypropanoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 8579079 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-phenoxypropanoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)CCOc2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-3-24(4-2)22(27)17-9-8-10-18(15-17)23-20(25)16-29-21(26)13-14-28-19-11-6-5-7-12-19/h5-12,15H,3-4,13-14,16H2,1-2H3,(H,23,25) |
| InChIKey | GDKCWVCFRGVMNR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |