C21H30N2O4 — CID 9197048
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 9197048) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 9197048 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)CCC2CCCC2)c1 |
| InChI | InChI=1S/C21H30N2O4/c1-3-23(4-2)21(26)17-10-7-11-18(14-17)22-19(24)15-27-20(25)13-12-16-8-5-6-9-16/h7,10-11,14,16H,3-6,8-9,12-13,15H2,1-2H3,(H,22,24) |
| InChIKey | NHOVEFKXDHMDRN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |