C20H29NO5 — CID 8580497
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 8580497) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 8580497 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CCC2CCCC2)cc1OCC |
| InChI | InChI=1S/C20H29NO5/c1-3-24-17-11-10-16(13-18(17)25-4-2)21-19(22)14-26-20(23)12-9-15-7-5-6-8-15/h10-11,13,15H,3-9,12,14H2,1-2H3,(H,21,22) |
| InChIKey | XIHVEELEJOGHHV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |