C24H23NO5 — CID 3952183
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 3952183) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 3952183 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCC1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H23NO5/c26-21(14-30-22(27)12-9-15-5-1-2-6-15)25-16-10-11-19-20(13-16)24(29)18-8-4-3-7-17(18)23(19)28/h3-4,7-8,10-11,13,15H,1-2,5-6,9,12,14H2,(H,25,26) |
| InChIKey | RSECQWNZPFOOHJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|