C18H25NO3 — CID 2521687
[2-(2,3-dimethylanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 2521687) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 2521687 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)CCC2CCCC2)c1C |
| InChI | InChI=1S/C18H25NO3/c1-13-6-5-9-16(14(13)2)19-17(20)12-22-18(21)11-10-15-7-3-4-8-15/h5-6,9,15H,3-4,7-8,10-12H2,1-2H3,(H,19,20) |
| InChIKey | LPYXOAGZOMDLPX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |