C21H31NO4 — CID 2335761
[2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 2335761) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 2335761 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | [2-(5-tert-butyl-2-methoxyanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)COC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C21H31NO4/c1-21(2,3)16-10-11-18(25-4)17(13-16)22-19(23)14-26-20(24)12-9-15-7-5-6-8-15/h10-11,13,15H,5-9,12,14H2,1-4H3,(H,22,23) |
| InChIKey | CFWLATPLEBNIMD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |