C16H19Cl2NO3 — CID 7751603
[2-(2,4-dichloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 7751603) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 7751603 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2NO3/c17-12-6-7-14(13(18)9-12)19-15(20)10-22-16(21)8-5-11-3-1-2-4-11/h6-7,9,11H,1-5,8,10H2,(H,19,20) |
| InChIKey | LIXDIVMLJOEDPB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |