C17H21BrFNO3 — CID 8815750
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 8815750) has the molecular formula C17H21BrFNO3 and a molecular weight of 386.26 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-cyclohexylpropanoate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 8815750 |
| Molecular Formula | C17H21BrFNO3 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCCC1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H21BrFNO3/c18-13-7-8-15(14(19)10-13)20-16(21)11-23-17(22)9-6-12-4-2-1-3-5-12/h7-8,10,12H,1-6,9,11H2,(H,20,21) |
| InChIKey | BAHWPKXJPVEQHB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |