C17H22BrNO3 — CID 46794459
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 46794459) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-cyclohexylacetate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 46794459 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C17H22BrNO3/c1-12-9-14(18)7-8-15(12)19-16(20)11-22-17(21)10-13-5-3-2-4-6-13/h7-9,13H,2-6,10-11H2,1H3,(H,19,20) |
| InChIKey | BKZYLFNKCKFWOG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |