C18H26BrN3O2 — CID 17432748
N-(4-bromo-2-methylphenyl)-2-[[2-[cyclohexyl(methyl)amino]acetyl]amino]acetamide (PubChem CID 17432748) has the molecular formula C18H26BrN3O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[2-[cyclohexyl(methyl)amino]acetyl]amino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[2-[cyclohexyl(methyl)amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 17432748 |
| Molecular Formula | C18H26BrN3O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[2-[cyclohexyl(methyl)amino]acetyl]amino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C18H26BrN3O2/c1-13-10-14(19)8-9-16(13)21-17(23)11-20-18(24)12-22(2)15-6-4-3-5-7-15/h8-10,15H,3-7,11-12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | KNSLMUQOLLIJFP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |