C14H21BrClN3O — CID 119922743
N-(4-bromo-2-methylphenyl)-2-[methyl(pyrrolidin-3-yl)amino]acetamide;hydrochloride (PubChem CID 119922743) has the molecular formula C14H21BrClN3O and a molecular weight of 362.70 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[methyl(pyrrolidin-3-yl)amino]acetamide;hydrochloride.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[methyl(pyrrolidin-3-yl)amino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922743 |
| Molecular Formula | C14H21BrClN3O |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[methyl(pyrrolidin-3-yl)amino]acetamide;hydrochloride |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C1CCNC1.Cl |
| InChI | InChI=1S/C14H20BrN3O.ClH/c1-10-7-11(15)3-4-13(10)17-14(19)9-18(2)12-5-6-16-8-12;/h3-4,7,12,16H,5-6,8-9H2,1-2H3,(H,17,19);1H |
| InChIKey | GJTAOTSKFUWZTA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |