C13H17Cl4N3O — CID 119922827
2-[methyl(pyrrolidin-3-yl)amino]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride (PubChem CID 119922827) has the molecular formula C13H17Cl4N3O and a molecular weight of 373.11 g/mol. Its IUPAC name is 2-[methyl(pyrrolidin-3-yl)amino]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride.
| Compound Name | 2-[methyl(pyrrolidin-3-yl)amino]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922827 |
| Molecular Formula | C13H17Cl4N3O |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2-[methyl(pyrrolidin-3-yl)amino]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
| SMILES | CN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)C1CCNC1.Cl |
| InChI | InChI=1S/C13H16Cl3N3O.ClH/c1-19(8-2-3-17-6-8)7-13(20)18-12-5-10(15)9(14)4-11(12)16;/h4-5,8,17H,2-3,6-7H2,1H3,(H,18,20);1H |
| InChIKey | NPDOUQLCLAGDJT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|