C14H20ClN3O — CID 55170845
N-[(2-chlorophenyl)methyl]-2-[methyl(pyrrolidin-3-yl)amino]acetamide (PubChem CID 55170845) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[methyl(pyrrolidin-3-yl)amino]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[methyl(pyrrolidin-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 55170845 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[methyl(pyrrolidin-3-yl)amino]acetamide |
| SMILES | CN(CC(=O)NCc1ccccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C14H20ClN3O/c1-18(12-6-7-16-9-12)10-14(19)17-8-11-4-2-3-5-13(11)15/h2-5,12,16H,6-10H2,1H3,(H,17,19) |
| InChIKey | QBUOQLQZUHCVBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |