C15H17ClFNO3 — CID 2617312
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 2617312) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 2617312 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | O=C(COC(=O)CC1CCCC1)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H17ClFNO3/c16-12-8-11(17)5-6-13(12)18-14(19)9-21-15(20)7-10-3-1-2-4-10/h5-6,8,10H,1-4,7,9H2,(H,18,19) |
| InChIKey | AYOPOTUQZZPNAA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |