C16H19FN2O5 — CID 4239986
[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 4239986) has the molecular formula C16H19FN2O5 and a molecular weight of 338.33 g/mol. Its IUPAC name is [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-cyclohexylacetate.
| Compound Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 4239986 |
| Molecular Formula | C16H19FN2O5 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | O=C(COC(=O)CC1CCCCC1)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19FN2O5/c17-12-6-7-13(14(9-12)19(22)23)18-15(20)10-24-16(21)8-11-4-2-1-3-5-11/h6-7,9,11H,1-5,8,10H2,(H,18,20) |
| InChIKey | UNZGNAHQADDPGE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|