C14H11FN2O5S — CID 4551993
[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 4551993) has the molecular formula C14H11FN2O5S and a molecular weight of 338.32 g/mol. Its IUPAC name is [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 4551993 |
| Molecular Formula | C14H11FN2O5S |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11FN2O5S/c15-10-1-2-11(12(6-10)17(20)21)16-13(18)7-22-14(19)5-9-3-4-23-8-9/h1-4,6,8H,5,7H2,(H,16,18) |
| InChIKey | PPQWIQHWAUDGQG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|