C11H9N3O5S2 — CID 23824251
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 23824251) has the molecular formula C11H9N3O5S2 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 23824251 |
| Molecular Formula | C11H9N3O5S2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H9N3O5S2/c15-8(13-11-12-4-9(21-11)14(17)18)5-19-10(16)3-7-1-2-20-6-7/h1-2,4,6H,3,5H2,(H,12,13,15) |
| InChIKey | WEPTWPKSHAWZFI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|