C14H11N3O5S — CID 6055491
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate (PubChem CID 6055491) has the molecular formula C14H11N3O5S and a molecular weight of 333.33 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6055491 |
| Molecular Formula | C14H11N3O5S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H11N3O5S/c18-11(16-14-15-8-12(23-14)17(20)21)9-22-13(19)7-6-10-4-2-1-3-5-10/h1-8H,9H2,(H,15,16,18)/b7-6+ |
| InChIKey | MZZAMCKQWXDLFN-VOTSOKGWSA-N |
| XLogP | 2.25 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|