About hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium
hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium (PubChem CID 153438146) has the molecular formula C19H14N3O5S+
and a molecular weight of 396.40 g/mol. Its IUPAC name is hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium.
Molecular Properties
| Compound Name | hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium |
| PubChem CID | 153438146 |
| Molecular Formula | C19H14N3O5S+ |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccccc1C(=O)Nc1ncc([N+](=O)O)s1 |
| InChI | InChI=1S/C19H13N3O5S/c23-17(11-10-13-6-2-1-3-7-13)27-15-9-5-4-8-14(15)18(24)21-19-20-12-16(28-19)22(25)26/h1-12H,(H-,20,21,24,25,26)/p+1/b11-10+ |
| InChIKey | ODDDXZPZTWPQKN-ZHACJKMWSA-O |
| XLogP | 3.81 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium?
The IUPAC name of hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium (CID 153438146) is hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium.
What is the SMILES notation for hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium?
The canonical SMILES for hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium is O=C(/C=C/c1ccccc1)Oc1ccccc1C(=O)Nc1ncc([N+](=O)O)s1.
What is the InChIKey of hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium?
The InChIKey is ODDDXZPZTWPQKN-ZHACJKMWSA-O. The full InChI is InChI=1S/C19H13N3O5S/c23-17(11-10-13-6-2-1-3-7-13)27-15-9-5-4-8-14(15)18(24)21-19-20-12-16(28-19)22(25)26/h1-12H,(H-,20,21,24,25,26)/p+1/b11-10+.
What are the key properties of hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium?
hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium has a molecular weight of 396.40 g/mol, XLogP of 3.81, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-[2-[[2-[(E)-3-phenylprop-2-enoyl]oxybenzoyl]amino]-1,3-thiazol-5-yl]azanium is sourced from PubChem (CID 153438146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).