C13H12N3O5S+ — CID 153438149
hydroxy-oxo-[2-[(2-propanoyloxybenzoyl)amino]-1,3-thiazol-5-yl]azanium (PubChem CID 153438149) has the molecular formula C13H12N3O5S+ and a molecular weight of 322.32 g/mol. Its IUPAC name is hydroxy-oxo-[2-[(2-propanoyloxybenzoyl)amino]-1,3-thiazol-5-yl]azanium.
| Compound Name | hydroxy-oxo-[2-[(2-propanoyloxybenzoyl)amino]-1,3-thiazol-5-yl]azanium |
|---|---|
| PubChem CID | 153438149 |
| Molecular Formula | C13H12N3O5S+ |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | hydroxy-oxo-[2-[(2-propanoyloxybenzoyl)amino]-1,3-thiazol-5-yl]azanium |
| SMILES | CCC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)O)s1 |
| InChI | InChI=1S/C13H11N3O5S/c1-2-11(17)21-9-6-4-3-5-8(9)12(18)15-13-14-7-10(22-13)16(19)20/h3-7H,2H2,1H3,(H-,14,15,18,19,20)/p+1 |
| InChIKey | NHQCEASMALWKCH-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|