C13H13N3O3S2 — CID 17310438
N-(5-nitro-1,3-thiazol-2-yl)-2-propylsulfanylbenzamide (PubChem CID 17310438) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-2-propylsulfanylbenzamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-2-propylsulfanylbenzamide |
|---|---|
| PubChem CID | 17310438 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-2-propylsulfanylbenzamide |
| SMILES | CCCSc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-2-7-20-10-6-4-3-5-9(10)12(17)15-13-14-8-11(21-13)16(18)19/h3-6,8H,2,7H2,1H3,(H,14,15,17) |
| InChIKey | FIEKFGINYOQJSL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|