C16H21N3OS3 — CID 17321811
N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-propylsulfanylbenzamide (PubChem CID 17321811) has the molecular formula C16H21N3OS3 and a molecular weight of 367.57 g/mol. Its IUPAC name is N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-propylsulfanylbenzamide.
| Compound Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-propylsulfanylbenzamide |
|---|---|
| PubChem CID | 17321811 |
| Molecular Formula | C16H21N3OS3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-propylsulfanylbenzamide |
| SMILES | CCCSc1ccccc1C(=O)Nc1nnc(SC(C)CC)s1 |
| InChI | InChI=1S/C16H21N3OS3/c1-4-10-21-13-9-7-6-8-12(13)14(20)17-15-18-19-16(23-15)22-11(3)5-2/h6-9,11H,4-5,10H2,1-3H3,(H,17,18,20) |
| InChIKey | MZCLAEWIDFFNDV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|