C14H16N4OS3 — CID 5190615
2-prop-2-enylsulfanyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 5190615) has the molecular formula C14H16N4OS3 and a molecular weight of 352.51 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-prop-2-enylsulfanyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5190615 |
| Molecular Formula | C14H16N4OS3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-prop-2-enylsulfanyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | C=CCSc1ncccc1C(=O)Nc1nnc(SCCC)s1 |
| InChI | InChI=1S/C14H16N4OS3/c1-3-8-20-12-10(6-5-7-15-12)11(19)16-13-17-18-14(22-13)21-9-4-2/h3,5-7H,1,4,8-9H2,2H3,(H,16,17,19) |
| InChIKey | XHFHJUQFDUZHFN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|