C16H16N6O2S4 — CID 3636543
1-N,2-N-bis(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzene-1,2-dicarboxamide (PubChem CID 3636543) has the molecular formula C16H16N6O2S4 and a molecular weight of 452.61 g/mol. Its IUPAC name is 1-N,2-N-bis(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3636543 |
| Molecular Formula | C16H16N6O2S4 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1-N,2-N-bis(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)benzene-1,2-dicarboxamide |
| SMILES | CCSc1nnc(NC(=O)c2ccccc2C(=O)Nc2nnc(SCC)s2)s1 |
| InChI | InChI=1S/C16H16N6O2S4/c1-3-25-15-21-19-13(27-15)17-11(23)9-7-5-6-8-10(9)12(24)18-14-20-22-16(28-14)26-4-2/h5-8H,3-4H2,1-2H3,(H,17,19,23)(H,18,20,24) |
| InChIKey | QCFMJKXEHPYSRC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|