C17H16N4O3S2 — CID 40505089
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-phenylmethoxypyridine-3-carboxamide (PubChem CID 40505089) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-phenylmethoxypyridine-3-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-phenylmethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 40505089 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-oxo-1-phenylmethoxypyridine-3-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cccn(OCc3ccccc3)c2=O)s1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-2-25-17-20-19-16(26-17)18-14(22)13-9-6-10-21(15(13)23)24-11-12-7-4-3-5-8-12/h3-10H,2,11H2,1H3,(H,18,19,22) |
| InChIKey | WAXMOJQGOZBVHP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|