C16H13N3O3S — CID 110382868
2-oxo-1-phenylmethoxy-N-(1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 110382868) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-oxo-1-phenylmethoxy-N-(1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-oxo-1-phenylmethoxy-N-(1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110382868 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-oxo-1-phenylmethoxy-N-(1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccn(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C16H13N3O3S/c20-14(18-16-17-8-10-23-16)13-7-4-9-19(15(13)21)22-11-12-5-2-1-3-6-12/h1-10H,11H2,(H,17,18,20) |
| InChIKey | HSUZYJZRYHOMRU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |