C15H12N4O2S — CID 91816331
6-phenylmethoxy-N-(1,3-thiazol-2-yl)pyrimidine-4-carboxamide (PubChem CID 91816331) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 6-phenylmethoxy-N-(1,3-thiazol-2-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-phenylmethoxy-N-(1,3-thiazol-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 91816331 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 6-phenylmethoxy-N-(1,3-thiazol-2-yl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(OCc2ccccc2)ncn1 |
| InChI | InChI=1S/C15H12N4O2S/c20-14(19-15-16-6-7-22-15)12-8-13(18-10-17-12)21-9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,16,19,20) |
| InChIKey | HAYNZAOHJSATHA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |