C21H19N3O4 — CID 121167835
ethyl 2-[(6-phenylmethoxypyrimidine-4-carbonyl)amino]benzoate (PubChem CID 121167835) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is ethyl 2-[(6-phenylmethoxypyrimidine-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(6-phenylmethoxypyrimidine-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 121167835 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl 2-[(6-phenylmethoxypyrimidine-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(OCc2ccccc2)ncn1 |
| InChI | InChI=1S/C21H19N3O4/c1-2-27-21(26)16-10-6-7-11-17(16)24-20(25)18-12-19(23-14-22-18)28-13-15-8-4-3-5-9-15/h3-12,14H,2,13H2,1H3,(H,24,25) |
| InChIKey | SYPJRESWGGUHJW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |