C19H16BrN3O2 — CID 121167981
N-(2-bromo-4-methylphenyl)-6-phenylmethoxypyrimidine-4-carboxamide (PubChem CID 121167981) has the molecular formula C19H16BrN3O2 and a molecular weight of 398.26 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-6-phenylmethoxypyrimidine-4-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-6-phenylmethoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167981 |
| Molecular Formula | C19H16BrN3O2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-6-phenylmethoxypyrimidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(OCc3ccccc3)ncn2)c(Br)c1 |
| InChI | InChI=1S/C19H16BrN3O2/c1-13-7-8-16(15(20)9-13)23-19(24)17-10-18(22-12-21-17)25-11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,23,24) |
| InChIKey | MKHCRKZTVLAJAW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |