C15H15N3O4 — CID 121167291
ethyl 2-[(6-methoxypyrimidine-4-carbonyl)amino]benzoate (PubChem CID 121167291) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is ethyl 2-[(6-methoxypyrimidine-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(6-methoxypyrimidine-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 121167291 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl 2-[(6-methoxypyrimidine-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(OC)ncn1 |
| InChI | InChI=1S/C15H15N3O4/c1-3-22-15(20)10-6-4-5-7-11(10)18-14(19)12-8-13(21-2)17-9-16-12/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | UNDWUAPRXKYHRK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |