C21H17N5O3 — CID 109359913
ethyl 2-[[6-(4-cyanoanilino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109359913) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is ethyl 2-[[6-(4-cyanoanilino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[6-(4-cyanoanilino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109359913 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | ethyl 2-[[6-(4-cyanoanilino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(Nc2ccc(C#N)cc2)ncn1 |
| InChI | InChI=1S/C21H17N5O3/c1-2-29-21(28)16-5-3-4-6-17(16)26-20(27)18-11-19(24-13-23-18)25-15-9-7-14(12-22)8-10-15/h3-11,13H,2H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | LECSDFFVIOHYKF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |