C20H16F2N4O3 — CID 109359813
ethyl 2-[[6-[(2,4-difluorophenyl)carbamoyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 109359813) has the molecular formula C20H16F2N4O3 and a molecular weight of 398.37 g/mol. Its IUPAC name is ethyl 2-[[6-[(2,4-difluorophenyl)carbamoyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-[(2,4-difluorophenyl)carbamoyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 109359813 |
| Molecular Formula | C20H16F2N4O3 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | ethyl 2-[[6-[(2,4-difluorophenyl)carbamoyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1cc(C(=O)Nc2ccc(F)cc2F)ncn1 |
| InChI | InChI=1S/C20H16F2N4O3/c1-2-29-20(28)13-5-3-4-6-15(13)25-18-10-17(23-11-24-18)19(27)26-16-8-7-12(21)9-14(16)22/h3-11H,2H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | DJUNLXMOFSVACU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |