C19H17F2N5O2 — CID 19153895
ethyl 2-[[5-amino-6-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 19153895) has the molecular formula C19H17F2N5O2 and a molecular weight of 385.37 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19153895 |
| Molecular Formula | C19H17F2N5O2 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | ethyl 2-[[5-amino-6-(2,4-difluoroanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C19H17F2N5O2/c1-2-28-19(27)12-5-3-4-6-14(12)25-17-16(22)18(24-10-23-17)26-15-8-7-11(20)9-13(15)21/h3-10H,2,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | DHNGOFTZPUUOFH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |