C18H14F2N2O2 — CID 46358297
ethyl 1-(2,4-difluoroanilino)isoquinoline-4-carboxylate (PubChem CID 46358297) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl 1-(2,4-difluoroanilino)isoquinoline-4-carboxylate.
| Compound Name | ethyl 1-(2,4-difluoroanilino)isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 46358297 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 1-(2,4-difluoroanilino)isoquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(F)cc2F)c2ccccc12 |
| InChI | InChI=1S/C18H14F2N2O2/c1-2-24-18(23)14-10-21-17(13-6-4-3-5-12(13)14)22-16-8-7-11(19)9-15(16)20/h3-10H,2H2,1H3,(H,21,22) |
| InChIKey | ULELHFFAWHODFZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |