C15H13F4N3O2 — CID 164529846
ethyl 4-(4-fluoro-2-methylanilino)-2-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 164529846) has the molecular formula C15H13F4N3O2 and a molecular weight of 343.28 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-2-methylanilino)-2-(trifluoromethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-fluoro-2-methylanilino)-2-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 164529846 |
| Molecular Formula | C15H13F4N3O2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | ethyl 4-(4-fluoro-2-methylanilino)-2-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)nc1Nc1ccc(F)cc1C |
| InChI | InChI=1S/C15H13F4N3O2/c1-3-24-13(23)10-7-20-14(15(17,18)19)22-12(10)21-11-5-4-9(16)6-8(11)2/h4-7H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | ZZLJOJDBNXAAEB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |