About ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate
ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate (PubChem CID 172639270) has the molecular formula C9H9ClF2N2O2
and a molecular weight of 250.63 g/mol. Its IUPAC name is ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate.
Analyze ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate (CID 172639270) is ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate is CCOC(=O)c1cnc(C(C)(F)F)nc1Cl.
What is the InChIKey of ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate?
The InChIKey is WZAPTSDBVSPNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF2N2O2/c1-3-16-7(15)5-4-13-8(9(2,11)12)14-6(5)10/h4H,3H2,1-2H3.
What are the key properties of ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate?
ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate has a molecular weight of 250.63 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-2-(1,1-difluoroethyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 172639270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).