C12H16ClN3O4 — CID 174635272
ethyl 4-chloro-2-[(3-ethoxy-3-oxopropyl)amino]pyrimidine-5-carboxylate (PubChem CID 174635272) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is ethyl 4-chloro-2-[(3-ethoxy-3-oxopropyl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-chloro-2-[(3-ethoxy-3-oxopropyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174635272 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | ethyl 4-chloro-2-[(3-ethoxy-3-oxopropyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)CCNc1ncc(C(=O)OCC)c(Cl)n1 |
| InChI | InChI=1S/C12H16ClN3O4/c1-3-19-9(17)5-6-14-12-15-7-8(10(13)16-12)11(18)20-4-2/h7H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | SEQGKBHWQHKNND-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |