C12H16F3N3O2 — CID 83178372
ethyl 4-methyl-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxylate (PubChem CID 83178372) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl 4-methyl-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 83178372 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 4-methyl-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCCC(F)(F)F)nc1C |
| InChI | InChI=1S/C12H16F3N3O2/c1-3-20-10(19)9-7-17-11(18-8(9)2)16-6-4-5-12(13,14)15/h7H,3-6H2,1-2H3,(H,16,17,18) |
| InChIKey | DZZRCYCCNIOTQB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|