C12H15F3N2O2 — CID 79040244
ethyl 6-(4,4,4-trifluorobutylamino)pyridine-3-carboxylate (PubChem CID 79040244) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is ethyl 6-(4,4,4-trifluorobutylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(4,4,4-trifluorobutylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 79040244 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ethyl 6-(4,4,4-trifluorobutylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-19-11(18)9-4-5-10(17-8-9)16-7-3-6-12(13,14)15/h4-5,8H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | QXTFJQBRTWFJRK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|