C13H18F3N3O — CID 115486588
N,N-dimethyl-6-(5,5,5-trifluoropentylamino)pyridine-3-carboxamide (PubChem CID 115486588) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is N,N-dimethyl-6-(5,5,5-trifluoropentylamino)pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-(5,5,5-trifluoropentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115486588 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N,N-dimethyl-6-(5,5,5-trifluoropentylamino)pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C13H18F3N3O/c1-19(2)12(20)10-5-6-11(18-9-10)17-8-4-3-7-13(14,15)16/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | FYLDAMIVPPHUDA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|