C12H16F3N3O — CID 115522150
6-(methylamino)-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide (PubChem CID 115522150) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 6-(methylamino)-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide.
| Compound Name | 6-(methylamino)-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115522150 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-(methylamino)-N-(5,5,5-trifluoropentyl)pyridine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)NCCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H16F3N3O/c1-16-10-5-4-9(8-18-10)11(19)17-7-3-2-6-12(13,14)15/h4-5,8H,2-3,6-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | LEHDVIBLJTWONW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|